C29H25FN4O — CID 46323420
2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-N-(3-phenylpropyl)quinoline-4-carboxamide (PubChem CID 46323420) has the molecular formula C29H25FN4O and a molecular weight of 464.54 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-N-(3-phenylpropyl)quinoline-4-carboxamide.
| Compound Name | 2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-N-(3-phenylpropyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 46323420 |
| Molecular Formula | C29H25FN4O |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-N-(3-phenylpropyl)quinoline-4-carboxamide |
| SMILES | Cc1c(-c2cc(C(=O)NCCCc3ccccc3)c3ccccc3n2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C29H25FN4O/c1-20-26(19-32-34(20)23-15-13-22(30)14-16-23)28-18-25(24-11-5-6-12-27(24)33-28)29(35)31-17-7-10-21-8-3-2-4-9-21/h2-6,8-9,11-16,18-19H,7,10,17H2,1H3,(H,31,35) |
| InChIKey | ORHAXEYFINIJDQ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|