C23H21FN4O — CID 20915284
1-(4-fluorophenyl)-N-(3-phenylpropyl)-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 20915284) has the molecular formula C23H21FN4O and a molecular weight of 388.45 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(3-phenylpropyl)-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-(3-phenylpropyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 20915284 |
| Molecular Formula | C23H21FN4O |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(3-phenylpropyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1cnn(-c2ccc(F)cc2)c1-n1cccc1 |
| InChI | InChI=1S/C23H21FN4O/c24-19-10-12-20(13-11-19)28-23(27-15-4-5-16-27)21(17-26-28)22(29)25-14-6-9-18-7-2-1-3-8-18/h1-5,7-8,10-13,15-17H,6,9,14H2,(H,25,29) |
| InChIKey | PDCSOGAZDBLMOK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|