C26H26FN5O — CID 20915312
N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-(4-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 20915312) has the molecular formula C26H26FN5O and a molecular weight of 443.53 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-(4-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-(4-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 20915312 |
| Molecular Formula | C26H26FN5O |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-(4-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | O=C(NCCCN1CCc2ccccc2C1)c1cnn(-c2ccc(F)cc2)c1-n1cccc1 |
| InChI | InChI=1S/C26H26FN5O/c27-22-8-10-23(11-9-22)32-26(31-15-3-4-16-31)24(18-29-32)25(33)28-13-5-14-30-17-12-20-6-1-2-7-21(20)19-30/h1-4,6-11,15-16,18H,5,12-14,17,19H2,(H,28,33) |
| InChIKey | AQOADTAIHUCZCT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|