C20H19FN6O — CID 86923114
1-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 86923114) has the molecular formula C20H19FN6O and a molecular weight of 378.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86923114 |
| Molecular Formula | C20H19FN6O |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1cnn(-c2ccc(F)cc2)c1-n1cccc1 |
| InChI | InChI=1S/C20H19FN6O/c21-16-4-6-17(7-5-16)27-20(26-11-1-2-12-26)18(14-24-27)19(28)23-8-3-10-25-13-9-22-15-25/h1-2,4-7,9,11-15H,3,8,10H2,(H,23,28) |
| InChIKey | ZFYTYBBEEVJZDN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|