C21H22FN5O2 — CID 20915361
1-(4-fluorophenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 20915361) has the molecular formula C21H22FN5O2 and a molecular weight of 395.44 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 20915361 |
| Molecular Formula | C21H22FN5O2 |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1cnn(-c2ccc(F)cc2)c1-n1cccc1 |
| InChI | InChI=1S/C21H22FN5O2/c22-16-6-8-17(9-7-16)27-21(26-11-1-2-12-26)18(15-24-27)20(29)23-10-4-14-25-13-3-5-19(25)28/h1-2,6-9,11-12,15H,3-5,10,13-14H2,(H,23,29) |
| InChIKey | LWEQGEZBLJYPDH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|