C15H18N6O — CID 47028243
N-(3-imidazol-1-ylpropyl)-1-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 47028243) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-1-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-1-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 47028243 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-1-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)NCCCn2ccnc2)c1-n1cccc1 |
| InChI | InChI=1S/C15H18N6O/c1-19-15(21-8-2-3-9-21)13(11-18-19)14(22)17-5-4-7-20-10-6-16-12-20/h2-3,6,8-12H,4-5,7H2,1H3,(H,17,22) |
| InChIKey | CFGLSDQEJDNHMD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 69.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|