C27H32FN5O — CID 20924239
N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-(4-fluorophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide (PubChem CID 20924239) has the molecular formula C27H32FN5O and a molecular weight of 461.59 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-(4-fluorophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-(4-fluorophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 20924239 |
| Molecular Formula | C27H32FN5O |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-(4-fluorophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide |
| SMILES | O=C(NCCCN1CCc2ccccc2C1)c1cnn(-c2ccc(F)cc2)c1C1CCNCC1 |
| InChI | InChI=1S/C27H32FN5O/c28-23-6-8-24(9-7-23)33-26(21-10-14-29-15-11-21)25(18-31-33)27(34)30-13-3-16-32-17-12-20-4-1-2-5-22(20)19-32/h1-2,4-9,18,21,29H,3,10-17,19H2,(H,30,34) |
| InChIKey | QHPPLEQQJALOEQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|