C23H34ClN7O3 — CID 146053303
N-[3-(4-methylpiperazin-1-yl)propyl]-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride (PubChem CID 146053303) has the molecular formula C23H34ClN7O3 and a molecular weight of 492.02 g/mol. Its IUPAC name is N-[3-(4-methylpiperazin-1-yl)propyl]-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride.
| Compound Name | N-[3-(4-methylpiperazin-1-yl)propyl]-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 146053303 |
| Molecular Formula | C23H34ClN7O3 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | N-[3-(4-methylpiperazin-1-yl)propyl]-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride |
| SMILES | CN1CCN(CCCNC(=O)c2cnn(-c3ccc([N+](=O)[O-])cc3)c2C2CCNCC2)CC1.Cl |
| InChI | InChI=1S/C23H33N7O3.ClH/c1-27-13-15-28(16-14-27)12-2-9-25-23(31)21-17-26-29(22(21)18-7-10-24-11-8-18)19-3-5-20(6-4-19)30(32)33;/h3-6,17-18,24H,2,7-16H2,1H3,(H,25,31);1H |
| InChIKey | LHGSGOZLMGCLAT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|