C20H28ClN5O4 — CID 146053286
N-(3-ethoxypropyl)-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride (PubChem CID 146053286) has the molecular formula C20H28ClN5O4 and a molecular weight of 437.93 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride.
| Compound Name | N-(3-ethoxypropyl)-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 146053286 |
| Molecular Formula | C20H28ClN5O4 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-(3-ethoxypropyl)-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride |
| SMILES | CCOCCCNC(=O)c1cnn(-c2ccc([N+](=O)[O-])cc2)c1C1CCNCC1.Cl |
| InChI | InChI=1S/C20H27N5O4.ClH/c1-2-29-13-3-10-22-20(26)18-14-23-24(19(18)15-8-11-21-12-9-15)16-4-6-17(7-5-16)25(27)28;/h4-7,14-15,21H,2-3,8-13H2,1H3,(H,22,26);1H |
| InChIKey | LTYLRYSLMOJECP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|