C21H19Cl2N5O3 — CID 46280275
N-(2,4-dichlorophenyl)-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide (PubChem CID 46280275) has the molecular formula C21H19Cl2N5O3 and a molecular weight of 460.32 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46280275 |
| Molecular Formula | C21H19Cl2N5O3 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | N-(2,4-dichlorophenyl)-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1cnn(-c2ccc([N+](=O)[O-])cc2)c1C1CCNCC1 |
| InChI | InChI=1S/C21H19Cl2N5O3/c22-14-1-6-19(18(23)11-14)26-21(29)17-12-25-27(20(17)13-7-9-24-10-8-13)15-2-4-16(5-3-15)28(30)31/h1-6,11-13,24H,7-10H2,(H,26,29) |
| InChIKey | HNVUNQXBNGIIHQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|