C23H26ClN5O3 — CID 146053274
N-(4-ethylphenyl)-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride (PubChem CID 146053274) has the molecular formula C23H26ClN5O3 and a molecular weight of 455.95 g/mol. Its IUPAC name is N-(4-ethylphenyl)-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride.
| Compound Name | N-(4-ethylphenyl)-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 146053274 |
| Molecular Formula | C23H26ClN5O3 |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N-(4-ethylphenyl)-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride |
| SMILES | CCc1ccc(NC(=O)c2cnn(-c3ccc([N+](=O)[O-])cc3)c2C2CCNCC2)cc1.Cl |
| InChI | InChI=1S/C23H25N5O3.ClH/c1-2-16-3-5-18(6-4-16)26-23(29)21-15-25-27(22(21)17-11-13-24-14-12-17)19-7-9-20(10-8-19)28(30)31;/h3-10,15,17,24H,2,11-14H2,1H3,(H,26,29);1H |
| InChIKey | ILRYDEOBJCLNEU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|