C25H29N5O5 — CID 46280284
N-[2-(2,5-dimethoxyphenyl)ethyl]-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide (PubChem CID 46280284) has the molecular formula C25H29N5O5 and a molecular weight of 479.54 g/mol. Its IUPAC name is N-[2-(2,5-dimethoxyphenyl)ethyl]-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide.
| Compound Name | N-[2-(2,5-dimethoxyphenyl)ethyl]-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46280284 |
| Molecular Formula | C25H29N5O5 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | N-[2-(2,5-dimethoxyphenyl)ethyl]-1-(4-nitrophenyl)-5-piperidin-4-ylpyrazole-4-carboxamide |
| SMILES | COc1ccc(OC)c(CCNC(=O)c2cnn(-c3ccc([N+](=O)[O-])cc3)c2C2CCNCC2)c1 |
| InChI | InChI=1S/C25H29N5O5/c1-34-21-7-8-23(35-2)18(15-21)11-14-27-25(31)22-16-28-29(24(22)17-9-12-26-13-10-17)19-3-5-20(6-4-19)30(32)33/h3-8,15-17,26H,9-14H2,1-2H3,(H,27,31) |
| InChIKey | KGCXFFUBIJWKRX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 120.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|