C18H21N5O — CID 20892553
N-[2-(dimethylamino)ethyl]-1-phenyl-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 20892553) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-1-phenyl-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-1-phenyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 20892553 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-1-phenyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | CN(C)CCNC(=O)c1cnn(-c2ccccc2)c1-n1cccc1 |
| InChI | InChI=1S/C18H21N5O/c1-21(2)13-10-19-17(24)16-14-20-23(15-8-4-3-5-9-15)18(16)22-11-6-7-12-22/h3-9,11-12,14H,10,13H2,1-2H3,(H,19,24) |
| InChIKey | IKYIHWMHWRMLQV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |