C29H30LiN3O3 — CID 11754695
lithium [(3-methoxyphenyl)-[[(Z)-1-(3-methoxyphenyl)-5-oxo-5-phenyl-3-(propan-2-ylamino)pent-3-enylidene]amino]methylidene]azanide (PubChem CID 11754695) has the molecular formula C29H30LiN3O3 and a molecular weight of 475.52 g/mol. Its IUPAC name is lithium [(3-methoxyphenyl)-[[(Z)-1-(3-methoxyphenyl)-5-oxo-5-phenyl-3-(propan-2-ylamino)pent-3-enylidene]amino]methylidene]azanide.
| Compound Name | lithium [(3-methoxyphenyl)-[[(Z)-1-(3-methoxyphenyl)-5-oxo-5-phenyl-3-(propan-2-ylamino)pent-3-enylidene]amino]methylidene]azanide |
|---|---|
| PubChem CID | 11754695 |
| Molecular Formula | C29H30LiN3O3 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | lithium [(3-methoxyphenyl)-[[(Z)-1-(3-methoxyphenyl)-5-oxo-5-phenyl-3-(propan-2-ylamino)pent-3-enylidene]amino]methylidene]azanide |
| SMILES | COc1cccc(C(=[N-])/N=C(/C/C(=C/C(=O)c2ccccc2)NC(C)C)c2cccc(OC)c2)c1.[Li+] |
| InChI | InChI=1S/C29H30N3O3.Li/c1-20(2)31-24(19-28(33)21-10-6-5-7-11-21)18-27(22-12-8-14-25(16-22)34-3)32-29(30)23-13-9-15-26(17-23)35-4;/h5-17,19-20,31H,18H2,1-4H3;/q-1;+1/b24-19-,32-27-; |
| InChIKey | DAPWPSKVDONVAU-NHRRVDFBSA-N |
| XLogP | 2.67 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|