C29H31N3O3 — CID 11754696
3-methoxy-N-[(Z)-1-(3-methoxyphenyl)-5-oxo-5-phenyl-3-(propan-2-ylamino)pent-3-enylidene]benzenecarboximidamide (PubChem CID 11754696) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is 3-methoxy-N-[(Z)-1-(3-methoxyphenyl)-5-oxo-5-phenyl-3-(propan-2-ylamino)pent-3-enylidene]benzenecarboximidamide.
| Compound Name | 3-methoxy-N-[(Z)-1-(3-methoxyphenyl)-5-oxo-5-phenyl-3-(propan-2-ylamino)pent-3-enylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 11754696 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 3-methoxy-N-[(Z)-1-(3-methoxyphenyl)-5-oxo-5-phenyl-3-(propan-2-ylamino)pent-3-enylidene]benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(/C/C(=C/C(=O)c1ccccc1)NC(C)C)c1cccc(OC)c1)c1cccc(OC)c1 |
| InChI | InChI=1S/C29H31N3O3/c1-20(2)31-24(19-28(33)21-10-6-5-7-11-21)18-27(22-12-8-14-25(16-22)34-3)32-29(30)23-13-9-15-26(17-23)35-4/h5-17,19-20,30-31H,18H2,1-4H3/b24-19-,30-29+,32-27- |
| InChIKey | VDNRKPYMGQXVHJ-WEHLFACESA-N |
| XLogP | 5.67 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|