C26H50O4Si2 — CID 11755023
(3R,4R,6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-8-methylidene-3-[(E)-1-trimethylsilyloxyprop-1-enoxy]dec-1-en-5-one (PubChem CID 11755023) has the molecular formula C26H50O4Si2 and a molecular weight of 482.85 g/mol. Its IUPAC name is (3R,4R,6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-8-methylidene-3-[(E)-1-trimethylsilyloxyprop-1-enoxy]dec-1-en-5-one.
| Compound Name | (3R,4R,6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-8-methylidene-3-[(E)-1-trimethylsilyloxyprop-1-enoxy]dec-1-en-5-one |
|---|---|
| PubChem CID | 11755023 |
| Molecular Formula | C26H50O4Si2 |
| Molecular Weight | 482.85 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | (3R,4R,6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-8-methylidene-3-[(E)-1-trimethylsilyloxyprop-1-enoxy]dec-1-en-5-one |
| SMILES | C=C(CC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)[C@H](C)[C@@H](O/C(=C\C)O[Si](C)(C)C)C(=C)C |
| InChI | InChI=1S/C26H50O4Si2/c1-16-19(5)25(30-32(14,15)26(8,9)10)21(7)23(27)20(6)24(18(3)4)28-22(17-2)29-31(11,12)13/h17,20-21,24-25H,3,5,16H2,1-2,4,6-15H3/b22-17+/t20-,21+,24-,25+/m0/s1 |
| InChIKey | QQOQREWJCITAMU-RYOVDBFTSA-N |
| XLogP | 7.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.85 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|