C33H62O9Si2 — CID 11721627
[(2E,4S,5R,7S,8R,9E)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-11-ethoxycarbonyloxy-3,5,7,9-tetramethyl-6-oxoundeca-2,9-dienyl] ethyl carbonate (PubChem CID 11721627) has the molecular formula C33H62O9Si2 and a molecular weight of 659.02 g/mol. Its IUPAC name is [(2E,4S,5R,7S,8R,9E)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-11-ethoxycarbonyloxy-3,5,7,9-tetramethyl-6-oxoundeca-2,9-dienyl] ethyl carbonate.
| Compound Name | [(2E,4S,5R,7S,8R,9E)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-11-ethoxycarbonyloxy-3,5,7,9-tetramethyl-6-oxoundeca-2,9-dienyl] ethyl carbonate |
|---|---|
| PubChem CID | 11721627 |
| Molecular Formula | C33H62O9Si2 |
| Molecular Weight | 659.02 g/mol |
| Exact Mass | 658.39 |
| IUPAC Name | [(2E,4S,5R,7S,8R,9E)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-11-ethoxycarbonyloxy-3,5,7,9-tetramethyl-6-oxoundeca-2,9-dienyl] ethyl carbonate |
| SMILES | CCOC(=O)OC/C=C(\C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/COC(=O)OCC |
| InChI | InChI=1S/C33H62O9Si2/c1-17-37-30(35)39-21-19-23(3)28(41-43(13,14)32(7,8)9)25(5)27(34)26(6)29(42-44(15,16)33(10,11)12)24(4)20-22-40-31(36)38-18-2/h19-20,25-26,28-29H,17-18,21-22H2,1-16H3/b23-19+,24-20+/t25-,26+,28+,29- |
| InChIKey | OOSPCEAPQBSEEW-UGWHJHAXSA-N |
| XLogP | 8.85 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.02 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|