C27H48O9Si — CID 11577505
[(2E,4S,5R,7S,8R,9E)-4-[tert-butyl(dimethyl)silyl]oxy-11-ethoxycarbonyloxy-8-hydroxy-3,5,7,9-tetramethyl-6-oxoundeca-2,9-dienyl] ethyl carbonate (PubChem CID 11577505) has the molecular formula C27H48O9Si and a molecular weight of 544.76 g/mol. Its IUPAC name is [(2E,4S,5R,7S,8R,9E)-4-[tert-butyl(dimethyl)silyl]oxy-11-ethoxycarbonyloxy-8-hydroxy-3,5,7,9-tetramethyl-6-oxoundeca-2,9-dienyl] ethyl carbonate.
| Compound Name | [(2E,4S,5R,7S,8R,9E)-4-[tert-butyl(dimethyl)silyl]oxy-11-ethoxycarbonyloxy-8-hydroxy-3,5,7,9-tetramethyl-6-oxoundeca-2,9-dienyl] ethyl carbonate |
|---|---|
| PubChem CID | 11577505 |
| Molecular Formula | C27H48O9Si |
| Molecular Weight | 544.76 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | [(2E,4S,5R,7S,8R,9E)-4-[tert-butyl(dimethyl)silyl]oxy-11-ethoxycarbonyloxy-8-hydroxy-3,5,7,9-tetramethyl-6-oxoundeca-2,9-dienyl] ethyl carbonate |
| SMILES | CCOC(=O)OC/C=C(\C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)[C@@H](C)[C@@H](O)/C(C)=C/COC(=O)OCC |
| InChI | InChI=1S/C27H48O9Si/c1-12-32-25(30)34-16-14-18(3)22(28)20(5)23(29)21(6)24(36-37(10,11)27(7,8)9)19(4)15-17-35-26(31)33-13-2/h14-15,20-22,24,28H,12-13,16-17H2,1-11H3/b18-14+,19-15+/t20-,21-,22-,24+/m0/s1 |
| InChIKey | XNJARWHLJVGTGD-VINRQENGSA-N |
| XLogP | 5.82 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.76 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|