C29H39N5O2 — CID 11755291
N-[[6-[[(7S,9aS)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-3-pyridinyl]methyl]-N-methylcyclohexanamine (PubChem CID 11755291) has the molecular formula C29H39N5O2 and a molecular weight of 489.66 g/mol. Its IUPAC name is N-[[6-[[(7S,9aS)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-3-pyridinyl]methyl]-N-methylcyclohexanamine.
| Compound Name | N-[[6-[[(7S,9aS)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-3-pyridinyl]methyl]-N-methylcyclohexanamine |
|---|---|
| PubChem CID | 11755291 |
| Molecular Formula | C29H39N5O2 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | N-[[6-[[(7S,9aS)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-3-pyridinyl]methyl]-N-methylcyclohexanamine |
| SMILES | CN(Cc1ccc(OC[C@H]2CC[C@H]3CN(c4noc5ccccc45)CCN3C2)nc1)C1CCCCC1 |
| InChI | InChI=1S/C29H39N5O2/c1-32(24-7-3-2-4-8-24)18-22-12-14-28(30-17-22)35-21-23-11-13-25-20-34(16-15-33(25)19-23)29-26-9-5-6-10-27(26)36-31-29/h5-6,9-10,12,14,17,23-25H,2-4,7-8,11,13,15-16,18-21H2,1H3/t23-,25-/m0/s1 |
| InChIKey | PVBOLKWECWAKHD-ZCYQVOJMSA-N |
| XLogP | 4.97 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |