C27H35N5O2 — CID 142677536
3-[(7R,9aR)-7-[[5-(piperidin-1-ylmethyl)-2-pyridinyl]oxymethyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-1,2-benzoxazole (PubChem CID 142677536) has the molecular formula C27H35N5O2 and a molecular weight of 461.61 g/mol. Its IUPAC name is 3-[(7R,9aR)-7-[[5-(piperidin-1-ylmethyl)-2-pyridinyl]oxymethyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-1,2-benzoxazole.
| Compound Name | 3-[(7R,9aR)-7-[[5-(piperidin-1-ylmethyl)-2-pyridinyl]oxymethyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 142677536 |
| Molecular Formula | C27H35N5O2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | 3-[(7R,9aR)-7-[[5-(piperidin-1-ylmethyl)-2-pyridinyl]oxymethyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-1,2-benzoxazole |
| SMILES | c1ccc2c(N3CCN4C[C@H](COc5ccc(CN6CCCCC6)cn5)CC[C@@H]4C3)noc2c1 |
| InChI | InChI=1S/C27H35N5O2/c1-4-12-30(13-5-1)17-21-9-11-26(28-16-21)33-20-22-8-10-23-19-32(15-14-31(23)18-22)27-24-6-2-3-7-25(24)34-29-27/h2-3,6-7,9,11,16,22-23H,1,4-5,8,10,12-15,17-20H2/t22-,23-/m1/s1 |
| InChIKey | JRXWUSGLSUKHDV-DHIUTWEWSA-N |
| XLogP | 4.19 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |