C32H48N4O4 — CID 11757349
2,5-bis[6-[ethyl(furan-2-ylmethyl)amino]hexylamino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 11757349) has the molecular formula C32H48N4O4 and a molecular weight of 552.76 g/mol. Its IUPAC name is 2,5-bis[6-[ethyl(furan-2-ylmethyl)amino]hexylamino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis[6-[ethyl(furan-2-ylmethyl)amino]hexylamino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 11757349 |
| Molecular Formula | C32H48N4O4 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.37 |
| IUPAC Name | 2,5-bis[6-[ethyl(furan-2-ylmethyl)amino]hexylamino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCN(CCCCCCNC1=CC(=O)C(NCCCCCCN(CC)Cc2ccco2)=CC1=O)Cc1ccco1 |
| InChI | InChI=1S/C32H48N4O4/c1-3-35(25-27-15-13-21-39-27)19-11-7-5-9-17-33-29-23-32(38)30(24-31(29)37)34-18-10-6-8-12-20-36(4-2)26-28-16-14-22-40-28/h13-16,21-24,33-34H,3-12,17-20,25-26H2,1-2H3 |
| InChIKey | YKCMZUSFFWAFBL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|