C20H18N6O2 — CID 11760534
1-benzyl-3-[(Z)-1,2-dicyano-2-[(4-methoxyanilino)methylideneamino]ethenyl]urea (PubChem CID 11760534) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 1-benzyl-3-[(Z)-1,2-dicyano-2-[(4-methoxyanilino)methylideneamino]ethenyl]urea.
| Compound Name | 1-benzyl-3-[(Z)-1,2-dicyano-2-[(4-methoxyanilino)methylideneamino]ethenyl]urea |
|---|---|
| PubChem CID | 11760534 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-benzyl-3-[(Z)-1,2-dicyano-2-[(4-methoxyanilino)methylideneamino]ethenyl]urea |
| SMILES | COc1ccc(N/C=N/C(C#N)=C(/C#N)NC(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H18N6O2/c1-28-17-9-7-16(8-10-17)24-14-25-18(11-21)19(12-22)26-20(27)23-13-15-5-3-2-4-6-15/h2-10,14H,13H2,1H3,(H,24,25)(H2,23,26,27)/b19-18- |
| InChIKey | CIAQKSAZOSLCDB-HNENSFHCSA-N |
| XLogP | 2.89 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|