C24H26N2O2 — CID 11760543
1,4-dimethyl-5,8-dipyrrolidin-1-ylanthracene-9,10-dione (PubChem CID 11760543) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 1,4-dimethyl-5,8-dipyrrolidin-1-ylanthracene-9,10-dione.
| Compound Name | 1,4-dimethyl-5,8-dipyrrolidin-1-ylanthracene-9,10-dione |
|---|---|
| PubChem CID | 11760543 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 1,4-dimethyl-5,8-dipyrrolidin-1-ylanthracene-9,10-dione |
| SMILES | Cc1ccc(C)c2c1C(=O)c1c(N3CCCC3)ccc(N3CCCC3)c1C2=O |
| InChI | InChI=1S/C24H26N2O2/c1-15-7-8-16(2)20-19(15)23(27)21-17(25-11-3-4-12-25)9-10-18(22(21)24(20)28)26-13-5-6-14-26/h7-10H,3-6,11-14H2,1-2H3 |
| InChIKey | OELZUNCERFEHPL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|