C18H20O6S2 — CID 11761103
dimethyl 2-[2-(benzenesulfonyl)-3-thiophen-3-ylpropyl]propanedioate (PubChem CID 11761103) has the molecular formula C18H20O6S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is dimethyl 2-[2-(benzenesulfonyl)-3-thiophen-3-ylpropyl]propanedioate.
| Compound Name | dimethyl 2-[2-(benzenesulfonyl)-3-thiophen-3-ylpropyl]propanedioate |
|---|---|
| PubChem CID | 11761103 |
| Molecular Formula | C18H20O6S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | dimethyl 2-[2-(benzenesulfonyl)-3-thiophen-3-ylpropyl]propanedioate |
| SMILES | COC(=O)C(CC(Cc1ccsc1)S(=O)(=O)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C18H20O6S2/c1-23-17(19)16(18(20)24-2)11-15(10-13-8-9-25-12-13)26(21,22)14-6-4-3-5-7-14/h3-9,12,15-16H,10-11H2,1-2H3 |
| InChIKey | HKUHEECATYCZDA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|