C19H27NO4S2 — CID 11761132
(3R)-3-(methoxymethoxy)-4-phenylmethoxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]butan-1-one (PubChem CID 11761132) has the molecular formula C19H27NO4S2 and a molecular weight of 397.56 g/mol. Its IUPAC name is (3R)-3-(methoxymethoxy)-4-phenylmethoxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]butan-1-one.
| Compound Name | (3R)-3-(methoxymethoxy)-4-phenylmethoxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]butan-1-one |
|---|---|
| PubChem CID | 11761132 |
| Molecular Formula | C19H27NO4S2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | (3R)-3-(methoxymethoxy)-4-phenylmethoxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]butan-1-one |
| SMILES | COCO[C@@H](COCc1ccccc1)CC(=O)N1C(=S)SC[C@@H]1C(C)C |
| InChI | InChI=1S/C19H27NO4S2/c1-14(2)17-12-26-19(25)20(17)18(21)9-16(24-13-22-3)11-23-10-15-7-5-4-6-8-15/h4-8,14,16-17H,9-13H2,1-3H3/t16-,17-/m1/s1 |
| InChIKey | DDSGPSQNNVDQKQ-IAGOWNOFSA-N |
| XLogP | 3.47 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|