C18H24BrNO2S2 — CID 135010813
(2S,3R)-4-bromo-2-methyl-3-phenylmethoxy-1-[(4R)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]butan-1-one (PubChem CID 135010813) has the molecular formula C18H24BrNO2S2 and a molecular weight of 430.43 g/mol. Its IUPAC name is (2S,3R)-4-bromo-2-methyl-3-phenylmethoxy-1-[(4R)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]butan-1-one.
| Compound Name | (2S,3R)-4-bromo-2-methyl-3-phenylmethoxy-1-[(4R)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]butan-1-one |
|---|---|
| PubChem CID | 135010813 |
| Molecular Formula | C18H24BrNO2S2 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | (2S,3R)-4-bromo-2-methyl-3-phenylmethoxy-1-[(4R)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]butan-1-one |
| SMILES | CC(C)[C@@H]1CSC(=S)N1C(=O)[C@@H](C)[C@H](CBr)OCc1ccccc1 |
| InChI | InChI=1S/C18H24BrNO2S2/c1-12(2)15-11-24-18(23)20(15)17(21)13(3)16(9-19)22-10-14-7-5-4-6-8-14/h4-8,12-13,15-16H,9-11H2,1-3H3/t13-,15-,16-/m0/s1 |
| InChIKey | INYLGOQFHCZYEH-BPUTZDHNSA-N |
| XLogP | 4.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|