C18H24BrNO3S2 — CID 10863217
(3S)-5-[(2-bromophenyl)methoxy]-3-hydroxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pentan-1-one (PubChem CID 10863217) has the molecular formula C18H24BrNO3S2 and a molecular weight of 446.43 g/mol. Its IUPAC name is (3S)-5-[(2-bromophenyl)methoxy]-3-hydroxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pentan-1-one.
| Compound Name | (3S)-5-[(2-bromophenyl)methoxy]-3-hydroxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pentan-1-one |
|---|---|
| PubChem CID | 10863217 |
| Molecular Formula | C18H24BrNO3S2 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | (3S)-5-[(2-bromophenyl)methoxy]-3-hydroxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pentan-1-one |
| SMILES | CC(C)[C@H]1CSC(=S)N1C(=O)C[C@@H](O)CCOCc1ccccc1Br |
| InChI | InChI=1S/C18H24BrNO3S2/c1-12(2)16-11-25-18(24)20(16)17(22)9-14(21)7-8-23-10-13-5-3-4-6-15(13)19/h3-6,12,14,16,21H,7-11H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | PNNFCDNAVJPSGR-GOEBONIOSA-N |
| XLogP | 3.99 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|