C20H29NO3S2 — CID 52921007
(2R,3R)-3-methoxy-2-methyl-5-phenylmethoxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pentan-1-one (PubChem CID 52921007) has the molecular formula C20H29NO3S2 and a molecular weight of 395.59 g/mol. Its IUPAC name is (2R,3R)-3-methoxy-2-methyl-5-phenylmethoxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pentan-1-one.
| Compound Name | (2R,3R)-3-methoxy-2-methyl-5-phenylmethoxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pentan-1-one |
|---|---|
| PubChem CID | 52921007 |
| Molecular Formula | C20H29NO3S2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (2R,3R)-3-methoxy-2-methyl-5-phenylmethoxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pentan-1-one |
| SMILES | CO[C@H](CCOCc1ccccc1)[C@@H](C)C(=O)N1C(=S)SC[C@@H]1C(C)C |
| InChI | InChI=1S/C20H29NO3S2/c1-14(2)17-13-26-20(25)21(17)19(22)15(3)18(23-4)10-11-24-12-16-8-6-5-7-9-16/h5-9,14-15,17-18H,10-13H2,1-4H3/t15-,17-,18-/m1/s1 |
| InChIKey | IVEPMHUPLHIXBF-KBAYOESNSA-N |
| XLogP | 4.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|