C26H31NO3S2 — CID 51354826
(3S,5S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-4,4-dimethyl-5-phenylmethoxyhept-6-en-1-one (PubChem CID 51354826) has the molecular formula C26H31NO3S2 and a molecular weight of 469.67 g/mol. Its IUPAC name is (3S,5S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-4,4-dimethyl-5-phenylmethoxyhept-6-en-1-one.
| Compound Name | (3S,5S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-4,4-dimethyl-5-phenylmethoxyhept-6-en-1-one |
|---|---|
| PubChem CID | 51354826 |
| Molecular Formula | C26H31NO3S2 |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | (3S,5S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-4,4-dimethyl-5-phenylmethoxyhept-6-en-1-one |
| SMILES | C=C[C@H](OCc1ccccc1)C(C)(C)[C@@H](O)CC(=O)N1C(=S)SC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C26H31NO3S2/c1-4-23(30-17-20-13-9-6-10-14-20)26(2,3)22(28)16-24(29)27-21(18-32-25(27)31)15-19-11-7-5-8-12-19/h4-14,21-23,28H,1,15-18H2,2-3H3/t21-,22+,23+/m1/s1 |
| InChIKey | KDNWGYZGNVIUPN-VJBWXMMDSA-N |
| XLogP | 5.01 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|