C20H21NO2S2 — CID 135054074
(2R,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-methyl-3-phenylpropan-1-one (PubChem CID 135054074) has the molecular formula C20H21NO2S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is (2R,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-methyl-3-phenylpropan-1-one.
| Compound Name | (2R,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-methyl-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 135054074 |
| Molecular Formula | C20H21NO2S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (2R,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-methyl-3-phenylpropan-1-one |
| SMILES | C[C@@H](C(=O)N1C(=S)SC[C@@H]1Cc1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H21NO2S2/c1-14(18(22)16-10-6-3-7-11-16)19(23)21-17(13-25-20(21)24)12-15-8-4-2-5-9-15/h2-11,14,17-18,22H,12-13H2,1H3/t14-,17+,18+/m1/s1 |
| InChIKey | LBIQPRAZYRAXQU-JLSDUUJJSA-N |
| XLogP | 3.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|