C13H14ClNO2S2 — CID 11255530
(2R,3R)-3-(4-chlorophenyl)-3-hydroxy-2-methyl-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)propan-1-one (PubChem CID 11255530) has the molecular formula C13H14ClNO2S2 and a molecular weight of 315.85 g/mol. Its IUPAC name is (2R,3R)-3-(4-chlorophenyl)-3-hydroxy-2-methyl-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)propan-1-one.
| Compound Name | (2R,3R)-3-(4-chlorophenyl)-3-hydroxy-2-methyl-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)propan-1-one |
|---|---|
| PubChem CID | 11255530 |
| Molecular Formula | C13H14ClNO2S2 |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | (2R,3R)-3-(4-chlorophenyl)-3-hydroxy-2-methyl-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)propan-1-one |
| SMILES | C[C@@H](C(=O)N1CCSC1=S)[C@@H](O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H14ClNO2S2/c1-8(12(17)15-6-7-19-13(15)18)11(16)9-2-4-10(14)5-3-9/h2-5,8,11,16H,6-7H2,1H3/t8-,11-/m1/s1 |
| InChIKey | QVTQFABIOSFUFF-LDYMZIIASA-N |
| XLogP | 2.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|