C23H27NO2S2 — CID 135054586
(2R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-[(S)-hydroxy(phenyl)methyl]-4-methylpentan-1-one (PubChem CID 135054586) has the molecular formula C23H27NO2S2 and a molecular weight of 413.61 g/mol. Its IUPAC name is (2R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-[(S)-hydroxy(phenyl)methyl]-4-methylpentan-1-one.
| Compound Name | (2R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-[(S)-hydroxy(phenyl)methyl]-4-methylpentan-1-one |
|---|---|
| PubChem CID | 135054586 |
| Molecular Formula | C23H27NO2S2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (2R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-[(S)-hydroxy(phenyl)methyl]-4-methylpentan-1-one |
| SMILES | CC(C)C[C@@H](C(=O)N1C(=S)SC[C@@H]1Cc1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C23H27NO2S2/c1-16(2)13-20(21(25)18-11-7-4-8-12-18)22(26)24-19(15-28-23(24)27)14-17-9-5-3-6-10-17/h3-12,16,19-21,25H,13-15H2,1-2H3/t19-,20+,21+/m0/s1 |
| InChIKey | LABPLZCNUCROHH-PWRODBHTSA-N |
| XLogP | 4.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|