C21H23NO2S2 — CID 135053944
(2R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-[(S)-hydroxy(phenyl)methyl]butan-1-one (PubChem CID 135053944) has the molecular formula C21H23NO2S2 and a molecular weight of 385.55 g/mol. Its IUPAC name is (2R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-[(S)-hydroxy(phenyl)methyl]butan-1-one.
| Compound Name | (2R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-[(S)-hydroxy(phenyl)methyl]butan-1-one |
|---|---|
| PubChem CID | 135053944 |
| Molecular Formula | C21H23NO2S2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (2R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-[(S)-hydroxy(phenyl)methyl]butan-1-one |
| SMILES | CC[C@@H](C(=O)N1C(=S)SC[C@@H]1Cc1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C21H23NO2S2/c1-2-18(19(23)16-11-7-4-8-12-16)20(24)22-17(14-26-21(22)25)13-15-9-5-3-6-10-15/h3-12,17-19,23H,2,13-14H2,1H3/t17-,18+,19+/m0/s1 |
| InChIKey | SSSSENSQAUIMMX-IPMKNSEASA-N |
| XLogP | 4.22 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|