C29H39NO3S2Si — CID 134844191
(E,3S,5R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-phenylhept-6-en-1-one (PubChem CID 134844191) has the molecular formula C29H39NO3S2Si and a molecular weight of 541.86 g/mol. Its IUPAC name is (E,3S,5R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-phenylhept-6-en-1-one.
| Compound Name | (E,3S,5R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-phenylhept-6-en-1-one |
|---|---|
| PubChem CID | 134844191 |
| Molecular Formula | C29H39NO3S2Si |
| Molecular Weight | 541.86 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | (E,3S,5R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-phenylhept-6-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](/C=C/c1ccccc1)C[C@H](O)CC(=O)N1C(=S)SC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C29H39NO3S2Si/c1-29(2,3)36(4,5)33-26(17-16-22-12-8-6-9-13-22)19-25(31)20-27(32)30-24(21-35-28(30)34)18-23-14-10-7-11-15-23/h6-17,24-26,31H,18-21H2,1-5H3/b17-16+/t24-,25-,26-/m0/s1 |
| InChIKey | HRBYGPBDJKKVRF-QRCURLSBSA-N |
| XLogP | 6.70 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.86 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|