C28H45NO3S2Si — CID 24884889
(2R,3S,4S,6R,7R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6-trimethylnon-8-en-1-one (PubChem CID 24884889) has the molecular formula C28H45NO3S2Si and a molecular weight of 535.89 g/mol. Its IUPAC name is (2R,3S,4S,6R,7R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6-trimethylnon-8-en-1-one.
| Compound Name | (2R,3S,4S,6R,7R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6-trimethylnon-8-en-1-one |
|---|---|
| PubChem CID | 24884889 |
| Molecular Formula | C28H45NO3S2Si |
| Molecular Weight | 535.89 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | (2R,3S,4S,6R,7R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6-trimethylnon-8-en-1-one |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C[C@H](C)[C@H](O)[C@@H](C)C(=O)N1C(=S)SC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C28H45NO3S2Si/c1-10-24(32-35(8,9)28(5,6)7)19(2)16-20(3)25(30)21(4)26(31)29-23(18-34-27(29)33)17-22-14-12-11-13-15-22/h10-15,19-21,23-25,30H,1,16-18H2,2-9H3/t19-,20+,21-,23+,24-,25+/m1/s1 |
| InChIKey | AEESZBOITFXOLU-JGIPNCKBSA-N |
| XLogP | 6.69 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.89 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|