C28H40N2O3S2Si — CID 11168762
(5R)-1-[(E)-but-2-enyl]-5-[(E,2S,3S)-1-oxo-5-phenyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-trimethylsilyloxypent-4-en-2-yl]pyrrolidin-2-one (PubChem CID 11168762) has the molecular formula C28H40N2O3S2Si and a molecular weight of 544.86 g/mol. Its IUPAC name is (5R)-1-[(E)-but-2-enyl]-5-[(E,2S,3S)-1-oxo-5-phenyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-trimethylsilyloxypent-4-en-2-yl]pyrrolidin-2-one.
| Compound Name | (5R)-1-[(E)-but-2-enyl]-5-[(E,2S,3S)-1-oxo-5-phenyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-trimethylsilyloxypent-4-en-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11168762 |
| Molecular Formula | C28H40N2O3S2Si |
| Molecular Weight | 544.86 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | (5R)-1-[(E)-but-2-enyl]-5-[(E,2S,3S)-1-oxo-5-phenyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-trimethylsilyloxypent-4-en-2-yl]pyrrolidin-2-one |
| SMILES | C/C=C/CN1C(=O)CC[C@@H]1[C@H](C(=O)N1C(=S)SC[C@@H]1C(C)C)[C@H](/C=C/c1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C28H40N2O3S2Si/c1-7-8-18-29-22(15-17-25(29)31)26(27(32)30-23(20(2)3)19-35-28(30)34)24(33-36(4,5)6)16-14-21-12-10-9-11-13-21/h7-14,16,20,22-24,26H,15,17-19H2,1-6H3/b8-7+,16-14+/t22-,23-,24+,26+/m1/s1 |
| InChIKey | LEVHAIYTNRFQSI-SJVKUMIISA-N |
| XLogP | 5.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.86 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|