C21H33NO2S2Si — CID 134842667
(3R)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxypentan-1-one (PubChem CID 134842667) has the molecular formula C21H33NO2S2Si and a molecular weight of 423.72 g/mol. Its IUPAC name is (3R)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxypentan-1-one.
| Compound Name | (3R)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxypentan-1-one |
|---|---|
| PubChem CID | 134842667 |
| Molecular Formula | C21H33NO2S2Si |
| Molecular Weight | 423.72 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (3R)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxypentan-1-one |
| SMILES | CC[C@H](CC(=O)N1C(=S)SC[C@H]1Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H33NO2S2Si/c1-7-18(24-27(5,6)21(2,3)4)14-19(23)22-17(15-26-20(22)25)13-16-11-9-8-10-12-16/h8-12,17-18H,7,13-15H2,1-6H3/t17-,18-/m1/s1 |
| InChIKey | HEFYAZPVSVMCQL-QZTJIDSGSA-N |
| XLogP | 5.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.72 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|