C22H33NO2S2Si — CID 101455399
(2R,3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-4-en-1-one (PubChem CID 101455399) has the molecular formula C22H33NO2S2Si and a molecular weight of 435.73 g/mol. Its IUPAC name is (2R,3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-4-en-1-one.
| Compound Name | (2R,3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-4-en-1-one |
|---|---|
| PubChem CID | 101455399 |
| Molecular Formula | C22H33NO2S2Si |
| Molecular Weight | 435.73 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | (2R,3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-4-en-1-one |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)N1C(=S)SC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C22H33NO2S2Si/c1-8-19(25-28(6,7)22(3,4)5)16(2)20(24)23-18(15-27-21(23)26)14-17-12-10-9-11-13-17/h8-13,16,18-19H,1,14-15H2,2-7H3/t16-,18-,19+/m1/s1 |
| InChIKey | MJAAOEAWUIPNIU-QRQLOZEOSA-N |
| XLogP | 5.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.73 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|