C21H21NO2S2 — CID 57386720
(E,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-5-phenylpent-4-en-1-one (PubChem CID 57386720) has the molecular formula C21H21NO2S2 and a molecular weight of 383.54 g/mol. Its IUPAC name is (E,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-5-phenylpent-4-en-1-one.
| Compound Name | (E,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-5-phenylpent-4-en-1-one |
|---|---|
| PubChem CID | 57386720 |
| Molecular Formula | C21H21NO2S2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | (E,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-5-phenylpent-4-en-1-one |
| SMILES | O=C(C[C@@H](O)/C=C/c1ccccc1)N1C(=S)SC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C21H21NO2S2/c23-19(12-11-16-7-3-1-4-8-16)14-20(24)22-18(15-26-21(22)25)13-17-9-5-2-6-10-17/h1-12,18-19,23H,13-15H2/b12-11+/t18-,19-/m0/s1 |
| InChIKey | UYZNWYZERNGRBZ-JUFISIKESA-N |
| XLogP | 3.92 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|