C22H23NO2S2 — CID 12964958
(E,2S,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-methyl-5-phenylpent-4-en-1-one (PubChem CID 12964958) has the molecular formula C22H23NO2S2 and a molecular weight of 397.57 g/mol. Its IUPAC name is (E,2S,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-methyl-5-phenylpent-4-en-1-one.
| Compound Name | (E,2S,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-methyl-5-phenylpent-4-en-1-one |
|---|---|
| PubChem CID | 12964958 |
| Molecular Formula | C22H23NO2S2 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | (E,2S,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-methyl-5-phenylpent-4-en-1-one |
| SMILES | C[C@H](C(=O)N1C(=S)SC[C@@H]1Cc1ccccc1)[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H23NO2S2/c1-16(20(24)13-12-17-8-4-2-5-9-17)21(25)23-19(15-27-22(23)26)14-18-10-6-3-7-11-18/h2-13,16,19-20,24H,14-15H2,1H3/b13-12+/t16-,19-,20-/m0/s1 |
| InChIKey | DWUOHBDDFNKIFI-ARSMWMFXSA-N |
| XLogP | 4.17 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|