C23H25NO2S2 — CID 12964962
(E,2S,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2,4-dimethyl-5-phenylpent-4-en-1-one (PubChem CID 12964962) has the molecular formula C23H25NO2S2 and a molecular weight of 411.59 g/mol. Its IUPAC name is (E,2S,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2,4-dimethyl-5-phenylpent-4-en-1-one.
| Compound Name | (E,2S,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2,4-dimethyl-5-phenylpent-4-en-1-one |
|---|---|
| PubChem CID | 12964962 |
| Molecular Formula | C23H25NO2S2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (E,2S,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2,4-dimethyl-5-phenylpent-4-en-1-one |
| SMILES | C/C(=C\c1ccccc1)[C@@H](O)[C@H](C)C(=O)N1C(=S)SC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H25NO2S2/c1-16(13-18-9-5-3-6-10-18)21(25)17(2)22(26)24-20(15-28-23(24)27)14-19-11-7-4-8-12-19/h3-13,17,20-21,25H,14-15H2,1-2H3/b16-13+/t17-,20-,21+/m0/s1 |
| InChIKey | DXCCZDKIFBEGHD-QJCVHLIGSA-N |
| XLogP | 4.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|