C19H25NO3S2 — CID 51357889
(2R,3S)-3-hydroxy-2-(phenylmethoxymethyl)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pent-4-en-1-one (PubChem CID 51357889) has the molecular formula C19H25NO3S2 and a molecular weight of 379.55 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-2-(phenylmethoxymethyl)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pent-4-en-1-one.
| Compound Name | (2R,3S)-3-hydroxy-2-(phenylmethoxymethyl)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 51357889 |
| Molecular Formula | C19H25NO3S2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | (2R,3S)-3-hydroxy-2-(phenylmethoxymethyl)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pent-4-en-1-one |
| SMILES | C=C[C@H](O)[C@@H](COCc1ccccc1)C(=O)N1C(=S)SC[C@@H]1C(C)C |
| InChI | InChI=1S/C19H25NO3S2/c1-4-17(21)15(11-23-10-14-8-6-5-7-9-14)18(22)20-16(13(2)3)12-25-19(20)24/h4-9,13,15-17,21H,1,10-12H2,2-3H3/t15-,16-,17+/m1/s1 |
| InChIKey | LKKPWPGPHBZVAE-ZACQAIPSSA-N |
| XLogP | 3.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|