C24H35NO3S2 — CID 11236266
(E,3R,6S,7S)-3-hydroxy-6,8-dimethyl-7-phenylmethoxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]non-4-en-1-one (PubChem CID 11236266) has the molecular formula C24H35NO3S2 and a molecular weight of 449.68 g/mol. Its IUPAC name is (E,3R,6S,7S)-3-hydroxy-6,8-dimethyl-7-phenylmethoxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]non-4-en-1-one.
| Compound Name | (E,3R,6S,7S)-3-hydroxy-6,8-dimethyl-7-phenylmethoxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]non-4-en-1-one |
|---|---|
| PubChem CID | 11236266 |
| Molecular Formula | C24H35NO3S2 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | (E,3R,6S,7S)-3-hydroxy-6,8-dimethyl-7-phenylmethoxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]non-4-en-1-one |
| SMILES | CC(C)[C@H]1CSC(=S)N1C(=O)C[C@@H](O)/C=C/[C@H](C)[C@@H](OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C24H35NO3S2/c1-16(2)21-15-30-24(29)25(21)22(27)13-20(26)12-11-18(5)23(17(3)4)28-14-19-9-7-6-8-10-19/h6-12,16-18,20-21,23,26H,13-15H2,1-5H3/b12-11+/t18-,20-,21+,23-/m0/s1 |
| InChIKey | TYXLHHSZLZUQQR-GGIJCATPSA-N |
| XLogP | 5.06 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|