C23H27NO3S2 — CID 72723512
(2R,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-methyl-5-phenylmethoxypentan-1-one (PubChem CID 72723512) has the molecular formula C23H27NO3S2 and a molecular weight of 429.61 g/mol. Its IUPAC name is (2R,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-methyl-5-phenylmethoxypentan-1-one.
| Compound Name | (2R,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-methyl-5-phenylmethoxypentan-1-one |
|---|---|
| PubChem CID | 72723512 |
| Molecular Formula | C23H27NO3S2 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (2R,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-methyl-5-phenylmethoxypentan-1-one |
| SMILES | C[C@@H](C(=O)N1C(=S)SC[C@@H]1Cc1ccccc1)[C@@H](O)CCOCc1ccccc1 |
| InChI | InChI=1S/C23H27NO3S2/c1-17(21(25)12-13-27-15-19-10-6-3-7-11-19)22(26)24-20(16-29-23(24)28)14-18-8-4-2-5-9-18/h2-11,17,20-21,25H,12-16H2,1H3/t17-,20+,21+/m1/s1 |
| InChIKey | DIARVQABWUOTQA-QMMLZNLJSA-N |
| XLogP | 4.06 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|