C21H20ClN3O2S — CID 1176169
4-chloro-N'-[2-(3,6,8-trimethylquinolin-2-yl)sulfanylacetyl]benzohydrazide (PubChem CID 1176169) has the molecular formula C21H20ClN3O2S and a molecular weight of 413.93 g/mol. Its IUPAC name is 4-chloro-N'-[2-(3,6,8-trimethylquinolin-2-yl)sulfanylacetyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-(3,6,8-trimethylquinolin-2-yl)sulfanylacetyl]benzohydrazide |
|---|---|
| PubChem CID | 1176169 |
| Molecular Formula | C21H20ClN3O2S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 4-chloro-N'-[2-(3,6,8-trimethylquinolin-2-yl)sulfanylacetyl]benzohydrazide |
| SMILES | Cc1cc(C)c2nc(SCC(=O)NNC(=O)c3ccc(Cl)cc3)c(C)cc2c1 |
| InChI | InChI=1S/C21H20ClN3O2S/c1-12-8-13(2)19-16(9-12)10-14(3)21(23-19)28-11-18(26)24-25-20(27)15-4-6-17(22)7-5-15/h4-10H,11H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | WXXHGMCCOZUANJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|