C28H27N3O3 — CID 11762189
(E)-N-[(4-acetamidophenyl)methyl]-2-cyano-3-[3-methyl-4-(2-phenylethoxy)phenyl]prop-2-enamide (PubChem CID 11762189) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is (E)-N-[(4-acetamidophenyl)methyl]-2-cyano-3-[3-methyl-4-(2-phenylethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(4-acetamidophenyl)methyl]-2-cyano-3-[3-methyl-4-(2-phenylethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 11762189 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | (E)-N-[(4-acetamidophenyl)methyl]-2-cyano-3-[3-methyl-4-(2-phenylethoxy)phenyl]prop-2-enamide |
| SMILES | CC(=O)Nc1ccc(CNC(=O)/C(C#N)=C/c2ccc(OCCc3ccccc3)c(C)c2)cc1 |
| InChI | InChI=1S/C28H27N3O3/c1-20-16-24(10-13-27(20)34-15-14-22-6-4-3-5-7-22)17-25(18-29)28(33)30-19-23-8-11-26(12-9-23)31-21(2)32/h3-13,16-17H,14-15,19H2,1-2H3,(H,30,33)(H,31,32)/b25-17+ |
| InChIKey | AAEFSQGMQVBELF-KOEQRZSOSA-N |
| XLogP | 4.80 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|