C21H34N2O6SSi — CID 11762453
benzyl (2S)-1-[(2R)-3-hydroxy-2-(2-trimethylsilylethylsulfonylamino)propanoyl]piperidine-2-carboxylate (PubChem CID 11762453) has the molecular formula C21H34N2O6SSi and a molecular weight of 470.66 g/mol. Its IUPAC name is benzyl (2S)-1-[(2R)-3-hydroxy-2-(2-trimethylsilylethylsulfonylamino)propanoyl]piperidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-[(2R)-3-hydroxy-2-(2-trimethylsilylethylsulfonylamino)propanoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 11762453 |
| Molecular Formula | C21H34N2O6SSi |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | benzyl (2S)-1-[(2R)-3-hydroxy-2-(2-trimethylsilylethylsulfonylamino)propanoyl]piperidine-2-carboxylate |
| SMILES | C[Si](C)(C)CCS(=O)(=O)N[C@H](CO)C(=O)N1CCCC[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H34N2O6SSi/c1-31(2,3)14-13-30(27,28)22-18(15-24)20(25)23-12-8-7-11-19(23)21(26)29-16-17-9-5-4-6-10-17/h4-6,9-10,18-19,22,24H,7-8,11-16H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | WEPIJTPEUHJFKF-MOPGFXCFSA-N |
| XLogP | 1.73 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|