C26H36FN5O9S — CID 11763421
cyano-tris(hydroxymethyl)azanium;(E,3R,5S)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dihydroxyhept-6-enoate (PubChem CID 11763421) has the molecular formula C26H36FN5O9S and a molecular weight of 613.67 g/mol. Its IUPAC name is cyano-tris(hydroxymethyl)azanium;(E,3R,5S)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dihydroxyhept-6-enoate.
| Compound Name | cyano-tris(hydroxymethyl)azanium;(E,3R,5S)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 11763421 |
| Molecular Formula | C26H36FN5O9S |
| Molecular Weight | 613.67 g/mol |
| Exact Mass | 613.22 |
| IUPAC Name | cyano-tris(hydroxymethyl)azanium;(E,3R,5S)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dihydroxyhept-6-enoate |
| SMILES | CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-].N#C[N+](CO)(CO)CO |
| InChI | InChI=1S/C22H28FN3O6S.C4H9N2O3/c1-13(2)20-18(10-9-16(27)11-17(28)12-19(29)30)21(14-5-7-15(23)8-6-14)25-22(24-20)26(3)33(4,31)32;5-1-6(2-7,3-8)4-9/h5-10,13,16-17,27-28H,11-12H2,1-4H3,(H,29,30);7-9H,2-4H2/q;+1/p-1/b10-9+;/t16-,17-;/m1./s1 |
| InChIKey | FMJAKYAXWXQMJY-DHMAKVBVSA-M |
| XLogP | -0.80 |
| TPSA | 228.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.67 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|