C44H56O4 — CID 11767464
(1R,17S,27S,28R)-6,12,19,25-tetratert-butyl-2,16-dioxaheptacyclo[21.3.1.11,4.114,17.117,21.03,8.010,15]triaconta-3(8),4,6,10(15),11,13,18,20,23,25-decaene-27,28-diol (PubChem CID 11767464) has the molecular formula C44H56O4 and a molecular weight of 648.93 g/mol. Its IUPAC name is (1R,17S,27S,28R)-6,12,19,25-tetratert-butyl-2,16-dioxaheptacyclo[21.3.1.11,4.114,17.117,21.03,8.010,15]triaconta-3(8),4,6,10(15),11,13,18,20,23,25-decaene-27,28-diol.
| Compound Name | (1R,17S,27S,28R)-6,12,19,25-tetratert-butyl-2,16-dioxaheptacyclo[21.3.1.11,4.114,17.117,21.03,8.010,15]triaconta-3(8),4,6,10(15),11,13,18,20,23,25-decaene-27,28-diol |
|---|---|
| PubChem CID | 11767464 |
| Molecular Formula | C44H56O4 |
| Molecular Weight | 648.93 g/mol |
| Exact Mass | 648.42 |
| IUPAC Name | (1R,17S,27S,28R)-6,12,19,25-tetratert-butyl-2,16-dioxaheptacyclo[21.3.1.11,4.114,17.117,21.03,8.010,15]triaconta-3(8),4,6,10(15),11,13,18,20,23,25-decaene-27,28-diol |
| SMILES | CC(C)(C)C1=C[C@]23Cc4cc(C(C)(C)C)cc(c4O2)Cc2cc(C(C)(C)C)cc4c2O[C@@]2(C=C(C(C)(C)C)C=C(CC(=C1)[C@H]3O)[C@@H]2O)C4 |
| InChI | InChI=1S/C44H56O4/c1-39(2,3)31-15-25-13-26-16-32(40(4,5)6)20-30-22-44(48-36(26)30)24-34(42(10,11)12)18-28(38(44)46)14-27-17-33(41(7,8)9)23-43(37(27)45)21-29(19-31)35(25)47-43/h15-20,23-24,37-38,45-46H,13-14,21-22H2,1-12H3/t37-,38+,43+,44- |
| InChIKey | CIHMZIWIKNENEU-PKOMPRKBSA-N |
| XLogP | 9.17 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.93 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |