C43H52O5 — CID 10699418
5,11,17-tritert-butyl-23-(oxiran-2-ylmethyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,26,27,28-tetrol (PubChem CID 10699418) has the molecular formula C43H52O5 and a molecular weight of 648.88 g/mol. Its IUPAC name is 5,11,17-tritert-butyl-23-(oxiran-2-ylmethyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,26,27,28-tetrol.
| Compound Name | 5,11,17-tritert-butyl-23-(oxiran-2-ylmethyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,26,27,28-tetrol |
|---|---|
| PubChem CID | 10699418 |
| Molecular Formula | C43H52O5 |
| Molecular Weight | 648.88 g/mol |
| Exact Mass | 648.38 |
| IUPAC Name | 5,11,17-tritert-butyl-23-(oxiran-2-ylmethyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,26,27,28-tetrol |
| SMILES | CC(C)(C)c1cc2c(O)c(c1)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(CC3CO3)cc(c1O)C2 |
| InChI | InChI=1S/C43H52O5/c1-41(2,3)33-17-27-13-25-10-24(12-36-23-48-36)11-26(37(25)44)14-28-18-34(42(4,5)6)20-30(39(28)46)16-32-22-35(43(7,8)9)21-31(40(32)47)15-29(19-33)38(27)45/h10-11,17-22,36,44-47H,12-16,23H2,1-9H3 |
| InChIKey | SGKYIXKTXHJYED-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.88 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|